C24H18FN3O2 — CID 135688673
(4S)-2-amino-4-(3-fluorophenyl)-7-hydroxy-6-[(2-methylphenyl)iminomethyl]-4H-chromene-3-carbonitrile (PubChem CID 135688673) has the molecular formula C24H18FN3O2 and a molecular weight of 399.43 g/mol. Its IUPAC name is (4S)-2-amino-4-(3-fluorophenyl)-7-hydroxy-6-[(2-methylphenyl)iminomethyl]-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(3-fluorophenyl)-7-hydroxy-6-[(2-methylphenyl)iminomethyl]-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 135688673 |
| Molecular Formula | C24H18FN3O2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (4S)-2-amino-4-(3-fluorophenyl)-7-hydroxy-6-[(2-methylphenyl)iminomethyl]-4H-chromene-3-carbonitrile |
| SMILES | Cc1ccccc1/N=C/c1cc2c(cc1O)OC(N)=C(C#N)[C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C24H18FN3O2/c1-14-5-2-3-8-20(14)28-13-16-10-18-22(11-21(16)29)30-24(27)19(12-26)23(18)15-6-4-7-17(25)9-15/h2-11,13,23,29H,27H2,1H3/b28-13+/t23-/m0/s1 |
| InChIKey | AUNGTYOFFMOUJR-MLVHTHFLSA-N |
| XLogP | 4.81 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|