C25H17FN2O2 — CID 5032104
2-amino-5-benzoyl-4-(3-fluorophenyl)-6-phenyl-4H-pyran-3-carbonitrile (PubChem CID 5032104) has the molecular formula C25H17FN2O2 and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-amino-5-benzoyl-4-(3-fluorophenyl)-6-phenyl-4H-pyran-3-carbonitrile.
| Compound Name | 2-amino-5-benzoyl-4-(3-fluorophenyl)-6-phenyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 5032104 |
| Molecular Formula | C25H17FN2O2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-amino-5-benzoyl-4-(3-fluorophenyl)-6-phenyl-4H-pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)OC(c2ccccc2)=C(C(=O)c2ccccc2)C1c1cccc(F)c1 |
| InChI | InChI=1S/C25H17FN2O2/c26-19-13-7-12-18(14-19)21-20(15-27)25(28)30-24(17-10-5-2-6-11-17)22(21)23(29)16-8-3-1-4-9-16/h1-14,21H,28H2 |
| InChIKey | FRDRANCVWUKXEC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |