C21H16N2O4 — CID 45490378
methyl 2-(6-amino-5-cyano-2,4-diphenyl-4H-pyran-3-yl)-2-oxoacetate (PubChem CID 45490378) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 2-(6-amino-5-cyano-2,4-diphenyl-4H-pyran-3-yl)-2-oxoacetate.
| Compound Name | methyl 2-(6-amino-5-cyano-2,4-diphenyl-4H-pyran-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 45490378 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | methyl 2-(6-amino-5-cyano-2,4-diphenyl-4H-pyran-3-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1=C(c2ccccc2)OC(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C21H16N2O4/c1-26-21(25)18(24)17-16(13-8-4-2-5-9-13)15(12-22)20(23)27-19(17)14-10-6-3-7-11-14/h2-11,16H,23H2,1H3 |
| InChIKey | XBKSHKYODKRLSU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|