C22H19N3O2 — CID 139060015
acetonitrile;(4S)-2-amino-5-benzoyl-6-methyl-4-phenyl-4H-pyran-3-carbonitrile (PubChem CID 139060015) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is acetonitrile;(4S)-2-amino-5-benzoyl-6-methyl-4-phenyl-4H-pyran-3-carbonitrile.
| Compound Name | acetonitrile;(4S)-2-amino-5-benzoyl-6-methyl-4-phenyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 139060015 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | acetonitrile;(4S)-2-amino-5-benzoyl-6-methyl-4-phenyl-4H-pyran-3-carbonitrile |
| SMILES | CC#N.CC1=C(C(=O)c2ccccc2)[C@@H](c2ccccc2)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C20H16N2O2.C2H3N/c1-13-17(19(23)15-10-6-3-7-11-15)18(14-8-4-2-5-9-14)16(12-21)20(22)24-13;1-2-3/h2-11,18H,22H2,1H3;1H3/t18-;/m0./s1 |
| InChIKey | WGWWAAHOTWSORZ-FERBBOLQSA-N |
| XLogP | 4.18 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |