C15H13N3O — CID 600102
2-amino-6-ethyl-4-phenyl-4H-pyran-3,5-dicarbonitrile (PubChem CID 600102) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-amino-6-ethyl-4-phenyl-4H-pyran-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-ethyl-4-phenyl-4H-pyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 600102 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-amino-6-ethyl-4-phenyl-4H-pyran-3,5-dicarbonitrile |
| SMILES | CCC1=C(C#N)C(c2ccccc2)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C15H13N3O/c1-2-13-11(8-16)14(10-6-4-3-5-7-10)12(9-17)15(18)19-13/h3-7,14H,2,18H2,1H3 |
| InChIKey | GSOBBMPXPFHHPL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |