C24H18N2O — CID 12957265
2-amino-4,5,6-triphenyl-4H-pyran-3-carbonitrile (PubChem CID 12957265) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-amino-4,5,6-triphenyl-4H-pyran-3-carbonitrile.
| Compound Name | 2-amino-4,5,6-triphenyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 12957265 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-amino-4,5,6-triphenyl-4H-pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)OC(c2ccccc2)=C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C24H18N2O/c25-16-20-21(17-10-4-1-5-11-17)22(18-12-6-2-7-13-18)23(27-24(20)26)19-14-8-3-9-15-19/h1-15,21H,26H2 |
| InChIKey | JGLFCLXNUSNNSM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|