C18H14N2O — CID 14066090
2-amino-4,6-diphenyl-4H-pyran-3-carbonitrile (PubChem CID 14066090) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-amino-4,6-diphenyl-4H-pyran-3-carbonitrile.
| Compound Name | 2-amino-4,6-diphenyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 14066090 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-amino-4,6-diphenyl-4H-pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)OC(c2ccccc2)=CC1c1ccccc1 |
| InChI | InChI=1S/C18H14N2O/c19-12-16-15(13-7-3-1-4-8-13)11-17(21-18(16)20)14-9-5-2-6-10-14/h1-11,15H,20H2 |
| InChIKey | FYEJDTQNJAYRKJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |