C31H31ClN4O2 — CID 11478040
N-[4-[6-amino-5-cyano-4-[4-(dimethylamino)phenyl]-4H-pyran-2-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide (PubChem CID 11478040) has the molecular formula C31H31ClN4O2 and a molecular weight of 527.07 g/mol. Its IUPAC name is N-[4-[6-amino-5-cyano-4-[4-(dimethylamino)phenyl]-4H-pyran-2-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide.
| Compound Name | N-[4-[6-amino-5-cyano-4-[4-(dimethylamino)phenyl]-4H-pyran-2-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 11478040 |
| Molecular Formula | C31H31ClN4O2 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | N-[4-[6-amino-5-cyano-4-[4-(dimethylamino)phenyl]-4H-pyran-2-yl]phenyl]-2-(4-chlorophenyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc(C2=CC(c3ccc(N(C)C)cc3)C(C#N)=C(N)O2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H31ClN4O2/c1-19(2)29(22-5-11-23(32)12-6-22)31(37)35-24-13-7-21(8-14-24)28-17-26(27(18-33)30(34)38-28)20-9-15-25(16-10-20)36(3)4/h5-17,19,26,29H,34H2,1-4H3,(H,35,37) |
| InChIKey | COEGZYDTBUONTD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|