C21H17FN2O3 — CID 171987305
benzyl 2-amino-5-cyano-4-(3-fluorophenyl)-6-methyl-4H-pyran-3-carboxylate (PubChem CID 171987305) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is benzyl 2-amino-5-cyano-4-(3-fluorophenyl)-6-methyl-4H-pyran-3-carboxylate.
| Compound Name | benzyl 2-amino-5-cyano-4-(3-fluorophenyl)-6-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 171987305 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | benzyl 2-amino-5-cyano-4-(3-fluorophenyl)-6-methyl-4H-pyran-3-carboxylate |
| SMILES | CC1=C(C#N)C(c2cccc(F)c2)C(C(=O)OCc2ccccc2)=C(N)O1 |
| InChI | InChI=1S/C21H17FN2O3/c1-13-17(11-23)18(15-8-5-9-16(22)10-15)19(20(24)27-13)21(25)26-12-14-6-3-2-4-7-14/h2-10,18H,12,24H2,1H3 |
| InChIKey | ADQAHGJYHYZDLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |