C19H16N2O4 — CID 1089863
benzyl (4S)-6-amino-5-cyano-4-(furan-3-yl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 1089863) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is benzyl (4S)-6-amino-5-cyano-4-(furan-3-yl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | benzyl (4S)-6-amino-5-cyano-4-(furan-3-yl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1089863 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | benzyl (4S)-6-amino-5-cyano-4-(furan-3-yl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@@H](c2ccoc2)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C19H16N2O4/c1-12-16(19(22)24-10-13-5-3-2-4-6-13)17(14-7-8-23-11-14)15(9-20)18(21)25-12/h2-8,11,17H,10,21H2,1H3/t17-/m0/s1 |
| InChIKey | VMZQTAYAGNYZQQ-KRWDZBQOSA-N |
| XLogP | 3.10 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |