C16H12N2O2 — CID 102204745
2-amino-4-(3-hydroxyphenyl)-4H-chromene-3-carbonitrile (PubChem CID 102204745) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-amino-4-(3-hydroxyphenyl)-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(3-hydroxyphenyl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 102204745 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-amino-4-(3-hydroxyphenyl)-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2ccccc2C1c1cccc(O)c1 |
| InChI | InChI=1S/C16H12N2O2/c17-9-13-15(10-4-3-5-11(19)8-10)12-6-1-2-7-14(12)20-16(13)18/h1-8,15,19H,18H2 |
| InChIKey | UQWANVHKYPRLMJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |