C27H18IN3O2 — CID 137231535
(4S)-2-amino-7-hydroxy-4-(3-iodophenyl)-6-(naphthalen-1-yliminomethyl)-4H-chromene-3-carbonitrile (PubChem CID 137231535) has the molecular formula C27H18IN3O2 and a molecular weight of 543.36 g/mol. Its IUPAC name is (4S)-2-amino-7-hydroxy-4-(3-iodophenyl)-6-(naphthalen-1-yliminomethyl)-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-7-hydroxy-4-(3-iodophenyl)-6-(naphthalen-1-yliminomethyl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 137231535 |
| Molecular Formula | C27H18IN3O2 |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | (4S)-2-amino-7-hydroxy-4-(3-iodophenyl)-6-(naphthalen-1-yliminomethyl)-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)c(/C=N/c3cccc4ccccc34)cc2[C@@H]1c1cccc(I)c1 |
| InChI | InChI=1S/C27H18IN3O2/c28-19-8-3-7-17(11-19)26-21-12-18(24(32)13-25(21)33-27(30)22(26)14-29)15-31-23-10-4-6-16-5-1-2-9-20(16)23/h1-13,15,26,32H,30H2/b31-15+/t26-/m0/s1 |
| InChIKey | WIMFQTJRDXYKHG-XMEUFVCPSA-N |
| XLogP | 6.12 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|