C15H10IN3O — CID 40527910
(4R)-2-amino-4-(3-iodophenyl)-4H-pyrano[2,3-c]pyridine-3-carbonitrile (PubChem CID 40527910) has the molecular formula C15H10IN3O and a molecular weight of 375.17 g/mol. Its IUPAC name is (4R)-2-amino-4-(3-iodophenyl)-4H-pyrano[2,3-c]pyridine-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(3-iodophenyl)-4H-pyrano[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 40527910 |
| Molecular Formula | C15H10IN3O |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | (4R)-2-amino-4-(3-iodophenyl)-4H-pyrano[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cnccc2[C@H]1c1cccc(I)c1 |
| InChI | InChI=1S/C15H10IN3O/c16-10-3-1-2-9(6-10)14-11-4-5-19-8-13(11)20-15(18)12(14)7-17/h1-6,8,14H,18H2/t14-/m1/s1 |
| InChIKey | XJNHDDYYEFDXHL-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|