C23H25N3O3 — CID 10111042
[3-[2-amino-3-cyano-7-(dimethylamino)-4H-chromen-4-yl]phenyl] 2-methylbutanoate (PubChem CID 10111042) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is [3-[2-amino-3-cyano-7-(dimethylamino)-4H-chromen-4-yl]phenyl] 2-methylbutanoate.
| Compound Name | [3-[2-amino-3-cyano-7-(dimethylamino)-4H-chromen-4-yl]phenyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 10111042 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [3-[2-amino-3-cyano-7-(dimethylamino)-4H-chromen-4-yl]phenyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1cccc(C2C(C#N)=C(N)Oc3cc(N(C)C)ccc32)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-5-14(2)23(27)28-17-8-6-7-15(11-17)21-18-10-9-16(26(3)4)12-20(18)29-22(25)19(21)13-24/h6-12,14,21H,5,25H2,1-4H3 |
| InChIKey | DDUQGIZPIAZCGW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|