C15H15N5S — CID 3625484
2,6-diamino-4-[4-(dimethylamino)phenyl]-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 3625484) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 2,6-diamino-4-[4-(dimethylamino)phenyl]-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 2,6-diamino-4-[4-(dimethylamino)phenyl]-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 3625484 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2,6-diamino-4-[4-(dimethylamino)phenyl]-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | CN(C)c1ccc(C2C(C#N)=C(N)SC(N)=C2C#N)cc1 |
| InChI | InChI=1S/C15H15N5S/c1-20(2)10-5-3-9(4-6-10)13-11(7-16)14(18)21-15(19)12(13)8-17/h3-6,13H,18-19H2,1-2H3 |
| InChIKey | GAJDJRNIBASHDS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|