C20H17N3O2 — CID 102222726
(4S)-2-amino-8-methoxy-4-(5-methyl-1H-indol-3-yl)-4H-chromene-3-carbonitrile (PubChem CID 102222726) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is (4S)-2-amino-8-methoxy-4-(5-methyl-1H-indol-3-yl)-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-8-methoxy-4-(5-methyl-1H-indol-3-yl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 102222726 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (4S)-2-amino-8-methoxy-4-(5-methyl-1H-indol-3-yl)-4H-chromene-3-carbonitrile |
| SMILES | COc1cccc2c1OC(N)=C(C#N)[C@H]2c1c[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C20H17N3O2/c1-11-6-7-16-13(8-11)15(10-23-16)18-12-4-3-5-17(24-2)19(12)25-20(22)14(18)9-21/h3-8,10,18,23H,22H2,1-2H3/t18-/m0/s1 |
| InChIKey | GMUILHKEUVENLU-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |