C23H17BrN2O3 — CID 5079449
2-amino-4-(5-bromo-2-phenylmethoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 5079449) has the molecular formula C23H17BrN2O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is 2-amino-4-(5-bromo-2-phenylmethoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(5-bromo-2-phenylmethoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 5079449 |
| Molecular Formula | C23H17BrN2O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-amino-4-(5-bromo-2-phenylmethoxyphenyl)-7-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)ccc2C1c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H17BrN2O3/c24-15-6-9-20(28-13-14-4-2-1-3-5-14)18(10-15)22-17-8-7-16(27)11-21(17)29-23(26)19(22)12-25/h1-11,22,27H,13,26H2 |
| InChIKey | JVLVQKHHIPFLKQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |