C20H14BrClN4OS — CID 4766256
2,6-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 4766256) has the molecular formula C20H14BrClN4OS and a molecular weight of 473.78 g/mol. Its IUPAC name is 2,6-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 2,6-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 4766256 |
| Molecular Formula | C20H14BrClN4OS |
| Molecular Weight | 473.78 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 2,6-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | N#CC1=C(N)SC(N)=C(C#N)C1c1cc(Br)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14BrClN4OS/c21-12-3-6-17(27-10-11-1-4-13(22)5-2-11)14(7-12)18-15(8-23)19(25)28-20(26)16(18)9-24/h1-7,18H,10,25-26H2 |
| InChIKey | PXCDYJMVJYJTRF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|