C22H16BrClN8O — CID 169380228
[5,7-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380228) has the molecular formula C22H16BrClN8O and a molecular weight of 523.78 g/mol. Its IUPAC name is [5,7-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380228 |
| Molecular Formula | C22H16BrClN8O |
| Molecular Weight | 523.78 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | [5,7-diamino-4-[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cc(Br)ccc2OCc2ccc(Cl)cc2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C22H16BrClN8O/c23-12-3-6-16(33-9-11-1-4-13(24)5-2-11)14(7-12)19-17-18(27)15(8-25)20(28)31-21(17)32-22(30-19)29-10-26/h1-7,19H,9H2,(H6,27,28,29,30,31,32) |
| InChIKey | FSIKAOVOFDSVDG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|