C15H10Br2N8O — CID 169378571
[5,7-diamino-6-cyano-4-(3,5-dibromo-2-hydroxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169378571) has the molecular formula C15H10Br2N8O and a molecular weight of 478.11 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(3,5-dibromo-2-hydroxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(3,5-dibromo-2-hydroxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169378571 |
| Molecular Formula | C15H10Br2N8O |
| Molecular Weight | 478.11 g/mol |
| Exact Mass | 475.93 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(3,5-dibromo-2-hydroxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cc(Br)cc(Br)c2O)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C15H10Br2N8O/c16-5-1-6(12(26)8(17)2-5)11-9-10(20)7(3-18)13(21)24-14(9)25-15(23-11)22-4-19/h1-2,11,26H,(H6,20,21,22,23,24,25) |
| InChIKey | UTJCLRCOYJXLQJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|