C17H15BrN8O2 — CID 169378898
[5,7-diamino-4-(2-bromo-5-ethoxy-4-hydroxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169378898) has the molecular formula C17H15BrN8O2 and a molecular weight of 443.27 g/mol. Its IUPAC name is [5,7-diamino-4-(2-bromo-5-ethoxy-4-hydroxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-(2-bromo-5-ethoxy-4-hydroxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169378898 |
| Molecular Formula | C17H15BrN8O2 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | [5,7-diamino-4-(2-bromo-5-ethoxy-4-hydroxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CCOc1cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c(Br)cc1O |
| InChI | InChI=1S/C17H15BrN8O2/c1-2-28-11-3-7(9(18)4-10(11)27)14-12-13(21)8(5-19)15(22)25-16(12)26-17(24-14)23-6-20/h3-4,14,27H,2H2,1H3,(H6,21,22,23,24,25,26) |
| InChIKey | JHBYELLTOQWPKY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 178.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|