C18H15F3N8O — CID 169380895
[5,7-diamino-6-cyano-4-[2-ethoxy-5-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380895) has the molecular formula C18H15F3N8O and a molecular weight of 416.37 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-ethoxy-5-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-ethoxy-5-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380895 |
| Molecular Formula | C18H15F3N8O |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-ethoxy-5-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CCOc1ccc(C(F)(F)F)cc1C1N=C(NC#N)Nc2nc(N)c(C#N)c(N)c21 |
| InChI | InChI=1S/C18H15F3N8O/c1-2-30-11-4-3-8(18(19,20)21)5-9(11)14-12-13(24)10(6-22)15(25)28-16(12)29-17(27-14)26-7-23/h3-5,14H,2H2,1H3,(H6,24,25,26,27,28,29) |
| InChIKey | MVXPYCCKAKUABS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|