C18H12F6N8O — CID 169380941
[5,7-diamino-6-cyano-4-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380941) has the molecular formula C18H12F6N8O and a molecular weight of 470.34 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380941 |
| Molecular Formula | C18H12F6N8O |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[3-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccc(C(F)(F)F)c(OCC(F)(F)F)c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C18H12F6N8O/c19-17(20,21)5-33-10-3-7(1-2-9(10)18(22,23)24)13-11-12(27)8(4-25)14(28)31-15(11)32-16(30-13)29-6-26/h1-3,13H,5H2,(H6,27,28,29,30,31,32) |
| InChIKey | HLLTZQGHGFWKHP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|