C19H10F10N8 — CID 169380943
[5,7-diamino-6-cyano-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380943) has the molecular formula C19H10F10N8 and a molecular weight of 540.33 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380943 |
| Molecular Formula | C19H10F10N8 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccc(C(F)(F)F)c(C(F)(F)C(F)(F)C(F)(F)F)c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C19H10F10N8/c20-16(21,18(25,26)19(27,28)29)9-3-6(1-2-8(9)17(22,23)24)12-10-11(32)7(4-30)13(33)36-14(10)37-15(35-12)34-5-31/h1-3,12H,(H6,32,33,34,35,36,37) |
| InChIKey | QDUGDBQDMVULKS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|