C17H13N9O2S — CID 169381263
[5,7-diamino-6-cyano-4-(3-cyano-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381263) has the molecular formula C17H13N9O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(3-cyano-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(3-cyano-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381263 |
| Molecular Formula | C17H13N9O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(3-cyano-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CS(=O)(=O)c1ccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)cc1C#N |
| InChI | InChI=1S/C17H13N9O2S/c1-29(27,28)11-3-2-8(4-9(11)5-18)14-12-13(21)10(6-19)15(22)25-16(12)26-17(24-14)23-7-20/h2-4,14H,1H3,(H6,21,22,23,24,25,26) |
| InChIKey | SHHZECFNJCFGGQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 206.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|