C18H16N8 — CID 169379616
[5,7-diamino-6-cyano-4-(3-cyclopropylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379616) has the molecular formula C18H16N8 and a molecular weight of 344.38 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(3-cyclopropylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(3-cyclopropylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379616 |
| Molecular Formula | C18H16N8 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(3-cyclopropylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cccc(C3CC3)c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C18H16N8/c19-7-12-14(21)13-15(11-3-1-2-10(6-11)9-4-5-9)24-18(23-8-20)26-17(13)25-16(12)22/h1-3,6,9,15H,4-5H2,(H6,21,22,23,24,25,26) |
| InChIKey | KDBDBSLTMUFDDS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|