C21H17BN8O2 — CID 169381447
[4-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]phenyl]boronic acid (PubChem CID 169381447) has the molecular formula C21H17BN8O2 and a molecular weight of 424.23 g/mol. Its IUPAC name is [4-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]phenyl]boronic acid.
| Compound Name | [4-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169381447 |
| Molecular Formula | C21H17BN8O2 |
| Molecular Weight | 424.23 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [4-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]phenyl]boronic acid |
| SMILES | N#CNC1=NC(c2cccc(-c3ccc(B(O)O)cc3)c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C21H17BN8O2/c23-9-15-17(25)16-18(28-21(27-10-24)30-20(16)29-19(15)26)13-3-1-2-12(8-13)11-4-6-14(7-5-11)22(31)32/h1-8,18,31-32H,(H6,25,26,27,28,29,30) |
| InChIKey | FBJPQIGFIARPIB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|