C22H15N9 — CID 169379404
[5,7-diamino-6-cyano-4-[2-(3-cyanophenyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379404) has the molecular formula C22H15N9 and a molecular weight of 405.43 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-(3-cyanophenyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-(3-cyanophenyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379404 |
| Molecular Formula | C22H15N9 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-(3-cyanophenyl)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccccc2-c2cccc(C#N)c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C22H15N9/c23-9-12-4-3-5-13(8-12)14-6-1-2-7-15(14)19-17-18(26)16(10-24)20(27)30-21(17)31-22(29-19)28-11-25/h1-8,19H,(H6,26,27,28,29,30,31) |
| InChIKey | KBJGLOFTHJOIFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 172.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|