C15H8F4N8 — CID 169381314
[5,7-diamino-6-cyano-4-(2,3,4,5-tetrafluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381314) has the molecular formula C15H8F4N8 and a molecular weight of 376.28 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(2,3,4,5-tetrafluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(2,3,4,5-tetrafluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381314 |
| Molecular Formula | C15H8F4N8 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(2,3,4,5-tetrafluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cc(F)c(F)c(F)c2F)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C15H8F4N8/c16-6-1-4(8(17)10(19)9(6)18)12-7-11(22)5(2-20)13(23)26-14(7)27-15(25-12)24-3-21/h1,12H,(H6,22,23,24,25,26,27) |
| InChIKey | QRPAITKUSDEWNK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|