C16H13FN8O2S — CID 169381372
[5,7-diamino-6-cyano-4-(2-fluoro-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381372) has the molecular formula C16H13FN8O2S and a molecular weight of 400.40 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(2-fluoro-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(2-fluoro-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381372 |
| Molecular Formula | C16H13FN8O2S |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(2-fluoro-4-methylsulfonylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CS(=O)(=O)c1ccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c(F)c1 |
| InChI | InChI=1S/C16H13FN8O2S/c1-28(26,27)7-2-3-8(10(17)4-7)13-11-12(20)9(5-18)14(21)24-15(11)25-16(23-13)22-6-19/h2-4,13H,1H3,(H6,20,21,22,23,24,25) |
| InChIKey | RWDMTDAHZFBLIC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 183.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|