C15H10ClFN8 — CID 169378591
[5,7-diamino-4-(5-chloro-2-fluorophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169378591) has the molecular formula C15H10ClFN8 and a molecular weight of 356.75 g/mol. Its IUPAC name is [5,7-diamino-4-(5-chloro-2-fluorophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-(5-chloro-2-fluorophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169378591 |
| Molecular Formula | C15H10ClFN8 |
| Molecular Weight | 356.75 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [5,7-diamino-4-(5-chloro-2-fluorophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cc(Cl)ccc2F)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C15H10ClFN8/c16-6-1-2-9(17)7(3-6)12-10-11(20)8(4-18)13(21)24-14(10)25-15(23-12)22-5-19/h1-3,12H,(H6,20,21,22,23,24,25) |
| InChIKey | LLHVGLIIOJPZQE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.75 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|