C18H18N8S — CID 169379063
[5,7-diamino-6-cyano-4-(3-propylsulfanylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379063) has the molecular formula C18H18N8S and a molecular weight of 378.47 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(3-propylsulfanylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(3-propylsulfanylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379063 |
| Molecular Formula | C18H18N8S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(3-propylsulfanylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CCCSc1cccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c1 |
| InChI | InChI=1S/C18H18N8S/c1-2-6-27-11-5-3-4-10(7-11)15-13-14(21)12(8-19)16(22)25-17(13)26-18(24-15)23-9-20/h3-5,7,15H,2,6H2,1H3,(H6,21,22,23,24,25,26) |
| InChIKey | SFHQPYJDGAVHCF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|