C17H14N8O2 — CID 169378799
[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl] acetate (PubChem CID 169378799) has the molecular formula C17H14N8O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is [3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl] acetate.
| Compound Name | [3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 169378799 |
| Molecular Formula | C17H14N8O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c1 |
| InChI | InChI=1S/C17H14N8O2/c1-8(26)27-10-4-2-3-9(5-10)14-12-13(20)11(6-18)15(21)24-16(12)25-17(23-14)22-7-19/h2-5,14H,1H3,(H6,20,21,22,23,24,25) |
| InChIKey | FCOZDBBEJRUNHY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|