C21H17N9O2S — CID 169380395
N-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide (PubChem CID 169380395) has the molecular formula C21H17N9O2S and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169380395 |
| Molecular Formula | C21H17N9O2S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N-[3-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide |
| SMILES | N#CNC1=NC(c2cccc(NS(=O)(=O)c3ccccc3)c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C21H17N9O2S/c22-10-15-17(24)16-18(27-21(26-11-23)29-20(16)28-19(15)25)12-5-4-6-13(9-12)30-33(31,32)14-7-2-1-3-8-14/h1-9,18,30H,(H6,24,25,26,27,28,29) |
| InChIKey | SLHGPLLVLGYKBI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|