C22H15N9O3S — CID 169379968
[5,7-diamino-6-cyano-4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379968) has the molecular formula C22H15N9O3S and a molecular weight of 485.49 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379968 |
| Molecular Formula | C22H15N9O3S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccc(OC3=NS(=O)(=O)c4ccccc43)cc2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C22H15N9O3S/c23-9-14-17(25)16-18(28-22(27-10-24)30-20(16)29-19(14)26)11-5-7-12(8-6-11)34-21-13-3-1-2-4-15(13)35(32,33)31-21/h1-8,18H,(H6,25,26,27,28,29,30) |
| InChIKey | RQBZQYYFPBLTFL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 204.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|