C23H19N9O2 — CID 169380911
benzyl N-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]carbamate (PubChem CID 169380911) has the molecular formula C23H19N9O2 and a molecular weight of 453.47 g/mol. Its IUPAC name is benzyl N-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]carbamate.
| Compound Name | benzyl N-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 169380911 |
| Molecular Formula | C23H19N9O2 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | benzyl N-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]carbamate |
| SMILES | N#CNC1=NC(c2ccc(NC(=O)OCc3ccccc3)cc2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C23H19N9O2/c24-10-16-18(26)17-19(30-22(28-12-25)32-21(17)31-20(16)27)14-6-8-15(9-7-14)29-23(33)34-11-13-4-2-1-3-5-13/h1-9,19H,11H2,(H,29,33)(H6,26,27,28,30,31,32) |
| InChIKey | IKAAHWGDBPPWGN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|