C22H15FN8O2 — CID 169379797
4-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]-3-fluorobenzoic acid (PubChem CID 169379797) has the molecular formula C22H15FN8O2 and a molecular weight of 442.41 g/mol. Its IUPAC name is 4-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 169379797 |
| Molecular Formula | C22H15FN8O2 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 4-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenyl]-3-fluorobenzoic acid |
| SMILES | N#CNC1=NC(c2ccc(-c3ccc(C(=O)O)cc3F)cc2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C22H15FN8O2/c23-15-7-12(21(32)33)5-6-13(15)10-1-3-11(4-2-10)18-16-17(26)14(8-24)19(27)30-20(16)31-22(29-18)28-9-25/h1-7,18H,(H,32,33)(H6,26,27,28,29,30,31) |
| InChIKey | XSTTYXSXCRNCPJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|