C24H20N8O3 — CID 169380290
[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 169380290) has the molecular formula C24H20N8O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is [4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 169380290 |
| Molecular Formula | C24H20N8O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H20N8O3/c1-12-3-5-13(6-4-12)23(33)35-16-8-7-14(9-17(16)34-2)20-18-19(27)15(10-25)21(28)31-22(18)32-24(30-20)29-11-26/h3-9,20H,1-2H3,(H6,27,28,29,30,31,32) |
| InChIKey | QBJHSRXXUPVUHJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|