C23H19BrN8O2 — CID 169380322
[5,7-diamino-4-[4-[(2-bromophenyl)methoxy]-3-methoxyphenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380322) has the molecular formula C23H19BrN8O2 and a molecular weight of 519.36 g/mol. Its IUPAC name is [5,7-diamino-4-[4-[(2-bromophenyl)methoxy]-3-methoxyphenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-[4-[(2-bromophenyl)methoxy]-3-methoxyphenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380322 |
| Molecular Formula | C23H19BrN8O2 |
| Molecular Weight | 519.36 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | [5,7-diamino-4-[4-[(2-bromophenyl)methoxy]-3-methoxyphenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | COc1cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)ccc1OCc1ccccc1Br |
| InChI | InChI=1S/C23H19BrN8O2/c1-33-17-8-12(6-7-16(17)34-10-13-4-2-3-5-15(13)24)20-18-19(27)14(9-25)21(28)31-22(18)32-23(30-20)29-11-26/h2-8,20H,10H2,1H3,(H6,27,28,29,30,31,32) |
| InChIKey | RVTAHEXYBZULEG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|