C24H21FN8O2 — CID 169379606
[5,7-diamino-6-cyano-4-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379606) has the molecular formula C24H21FN8O2 and a molecular weight of 472.48 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379606 |
| Molecular Formula | C24H21FN8O2 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CCOc1cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C24H21FN8O2/c1-2-34-18-9-14(6-7-17(18)35-11-13-4-3-5-15(25)8-13)21-19-20(28)16(10-26)22(29)32-23(19)33-24(31-21)30-12-27/h3-9,21H,2,11H2,1H3,(H6,28,29,30,31,32,33) |
| InChIKey | UELCTAJWYWWZRF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|