C22H18N8O4 — CID 169380302
[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenyl] furan-2-carboxylate (PubChem CID 169380302) has the molecular formula C22H18N8O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is [4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 169380302 |
| Molecular Formula | C22H18N8O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H18N8O4/c1-2-32-15-8-11(5-6-13(15)34-21(31)14-4-3-7-33-14)18-16-17(25)12(9-23)19(26)29-20(16)30-22(28-18)27-10-24/h3-8,18H,2H2,1H3,(H6,25,26,27,28,29,30) |
| InChIKey | VJERKRCRTHBMIU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 197.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|