C23H18N10O6 — CID 169380510
[5,7-diamino-6-cyano-4-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380510) has the molecular formula C23H18N10O6 and a molecular weight of 530.46 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380510 |
| Molecular Formula | C23H18N10O6 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CCOc1cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18N10O6/c1-2-38-17-7-11(3-5-16(17)39-15-6-4-12(32(34)35)8-14(15)33(36)37)20-18-19(26)13(9-24)21(27)30-22(18)31-23(29-20)28-10-25/h3-8,20H,2H2,1H3,(H6,26,27,28,29,30,31) |
| InChIKey | JSYHSIGAUUTSNP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 253.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|