C22H17N9O3 — CID 169381103
[5,7-diamino-6-cyano-4-(3-nitro-4-phenylmethoxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381103) has the molecular formula C22H17N9O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(3-nitro-4-phenylmethoxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(3-nitro-4-phenylmethoxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381103 |
| Molecular Formula | C22H17N9O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(3-nitro-4-phenylmethoxyphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C22H17N9O3/c23-9-14-18(25)17-19(28-22(27-11-24)30-21(17)29-20(14)26)13-6-7-16(15(8-13)31(32)33)34-10-12-4-2-1-3-5-12/h1-8,19H,10H2,(H6,25,26,27,28,29,30) |
| InChIKey | VWLDNQZIIBXDCW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 201.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|