C27H26N10O3 — CID 169380860
[5,7-diamino-6-cyano-4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380860) has the molecular formula C27H26N10O3 and a molecular weight of 538.57 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380860 |
| Molecular Formula | C27H26N10O3 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | COc1ccccc1C1CCN(c2ccc(C3N=C(NC#N)Nc4nc(N)c(C#N)c(N)c43)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H26N10O3/c1-40-21-5-3-2-4-17(21)15-8-10-36(11-9-15)19-7-6-16(12-20(19)37(38)39)24-22-23(30)18(13-28)25(31)34-26(22)35-27(33-24)32-14-29/h2-7,12,15,24H,8-11H2,1H3,(H6,30,31,32,33,34,35) |
| InChIKey | LPTOIBIMCWTSCE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 204.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|