C16H12BrN9O4 — CID 169379456
[5,7-diamino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169379456) has the molecular formula C16H12BrN9O4 and a molecular weight of 474.24 g/mol. Its IUPAC name is [5,7-diamino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169379456 |
| Molecular Formula | C16H12BrN9O4 |
| Molecular Weight | 474.24 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | [5,7-diamino-4-(2-bromo-6-hydroxy-5-methoxy-3-nitrophenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | COc1cc([N+](=O)[O-])c(Br)c(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c1O |
| InChI | InChI=1S/C16H12BrN9O4/c1-30-7-2-6(26(28)29)10(17)8(13(7)27)12-9-11(20)5(3-18)14(21)24-15(9)25-16(23-12)22-4-19/h2,12,27H,1H3,(H6,20,21,22,23,24,25) |
| InChIKey | OCZOHYMTSVMBKB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 221.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|