C16H9BrF3N9O3 — CID 169381402
[5,7-diamino-4-[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381402) has the molecular formula C16H9BrF3N9O3 and a molecular weight of 512.21 g/mol. Its IUPAC name is [5,7-diamino-4-[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381402 |
| Molecular Formula | C16H9BrF3N9O3 |
| Molecular Weight | 512.21 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | [5,7-diamino-4-[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cc(Br)c(OC(F)(F)F)c([N+](=O)[O-])c2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C16H9BrF3N9O3/c17-7-1-5(2-8(29(30)31)12(7)32-16(18,19)20)11-9-10(23)6(3-21)13(24)27-14(9)28-15(26-11)25-4-22/h1-2,11H,(H6,23,24,25,26,27,28) |
| InChIKey | NUVLUNGGNNKSSF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 201.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|