C17H15BrN8O3 — CID 169381412
[5,7-diamino-4-(5-bromo-2-hydroxy-3,4-dimethoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381412) has the molecular formula C17H15BrN8O3 and a molecular weight of 459.26 g/mol. Its IUPAC name is [5,7-diamino-4-(5-bromo-2-hydroxy-3,4-dimethoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-(5-bromo-2-hydroxy-3,4-dimethoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381412 |
| Molecular Formula | C17H15BrN8O3 |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | [5,7-diamino-4-(5-bromo-2-hydroxy-3,4-dimethoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | COc1c(Br)cc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)c(O)c1OC |
| InChI | InChI=1S/C17H15BrN8O3/c1-28-13-8(18)3-6(12(27)14(13)29-2)11-9-10(21)7(4-19)15(22)25-16(9)26-17(24-11)23-5-20/h3,11,27H,1-2H3,(H6,21,22,23,24,25,26) |
| InChIKey | XGTIZDYDRXTVBJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|