C21H22N8O4 — CID 169380508
ethyl 2-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenoxy]acetate (PubChem CID 169380508) has the molecular formula C21H22N8O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is ethyl 2-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 169380508 |
| Molecular Formula | C21H22N8O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | ethyl 2-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C2N=C(NC#N)Nc3nc(N)c(C#N)c(N)c32)cc1OCC |
| InChI | InChI=1S/C21H22N8O4/c1-3-31-14-7-11(5-6-13(14)33-9-15(30)32-4-2)18-16-17(24)12(8-22)19(25)28-20(16)29-21(27-18)26-10-23/h5-7,18H,3-4,9H2,1-2H3,(H6,24,25,26,27,28,29) |
| InChIKey | KEGDEABZXAKSCF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 193.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|