C26H24N8O4 — CID 169381165
methyl 4-[3-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenoxy]propoxy]benzoate (PubChem CID 169381165) has the molecular formula C26H24N8O4 and a molecular weight of 512.53 g/mol. Its IUPAC name is methyl 4-[3-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenoxy]propoxy]benzoate.
| Compound Name | methyl 4-[3-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenoxy]propoxy]benzoate |
|---|---|
| PubChem CID | 169381165 |
| Molecular Formula | C26H24N8O4 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | methyl 4-[3-[4-[5,7-diamino-6-cyano-2-(cyanoamino)-1,4-dihydropyrido[2,3-d]pyrimidin-4-yl]phenoxy]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCOc2ccc(C3N=C(NC#N)Nc4nc(N)c(C#N)c(N)c43)cc2)cc1 |
| InChI | InChI=1S/C26H24N8O4/c1-36-25(35)16-5-9-18(10-6-16)38-12-2-11-37-17-7-3-15(4-8-17)22-20-21(29)19(13-27)23(30)33-24(20)34-26(32-22)31-14-28/h3-10,22H,2,11-12H2,1H3,(H6,29,30,31,32,33,34) |
| InChIKey | RMHQPTWHXSXLPJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 193.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|