C26H21N9O3 — CID 169381067
[5,7-diamino-6-cyano-4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381067) has the molecular formula C26H21N9O3 and a molecular weight of 507.51 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381067 |
| Molecular Formula | C26H21N9O3 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2ccc(OCCCN3C(=O)c4ccccc4C3=O)cc2)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C26H21N9O3/c27-12-18-20(29)19-21(32-26(31-13-28)34-23(19)33-22(18)30)14-6-8-15(9-7-14)38-11-3-10-35-24(36)16-4-1-2-5-17(16)25(35)37/h1-2,4-9,21H,3,10-11H2,(H6,29,30,31,32,33,34) |
| InChIKey | XGQVXFKOVVRPEU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 195.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|